| Name | 4,4'-Dichlorobenzophenone |
| Synonyms | 4,4'-DBP usafdo-4 USAF do-4 p-Dichlorobenzophenone 4,4-Dichloro Benzophenone 4,4'-Dichlorobenzophenone BIS(4-CHLOROPHENYL) KETONE benzophenone,4,4'-dichloro- Benzophenone, 4,4'-dichloro- BIS-(4-CHLORO-PHENYL)-METHANONE |
| CAS | 90-98-2 |
| EINECS | 202-030-1 |
| InChI | InChI=1/C13H8Cl2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| Molecular Formula | C13H8Cl2O |
| Molar Mass | 251.11 |
| Density | 1,45 g/cm3 |
| Melting Point | 144-146 °C (lit.) |
| Boling Point | 353 °C (lit.) |
| Flash Point | 352-354°C |
| Solubility | Soluble in chloroform, ether, soluble in hot ethanol, acetone, acetic acid and carbon disulfide. |
| Appearance | White-like crystal |
| Color | White to Light yellow |
| BRN | 643345 |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.5555 (estimate) |
| MDL | MFCD00000623 |
| Physical and Chemical Properties | Melting point 144-147°C boiling point 353°C |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | DJ0525000 |
| TSCA | Yes |
| HS Code | 29147000 |
| Hazard Note | Irritant |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for pharmaceutical intermediates |